C19H26FIN4O3S — CID 110942157
1-[[3-[(3-fluorophenyl)methylsulfamoyl]phenyl]methyl]-3-(2-methoxyethyl)-2-methylguanidine;hydroiodide (PubChem CID 110942157) has the molecular formula C19H26FIN4O3S and a molecular weight of 536.41 g/mol. Its IUPAC name is 1-[[3-[(3-fluorophenyl)methylsulfamoyl]phenyl]methyl]-3-(2-methoxyethyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-[[3-[(3-fluorophenyl)methylsulfamoyl]phenyl]methyl]-3-(2-methoxyethyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110942157 |
| Molecular Formula | C19H26FIN4O3S |
| Molecular Weight | 536.41 g/mol |
| Exact Mass | 536.08 |
| IUPAC Name | 1-[[3-[(3-fluorophenyl)methylsulfamoyl]phenyl]methyl]-3-(2-methoxyethyl)-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCOC)NCc1cccc(S(=O)(=O)NCc2cccc(F)c2)c1.I |
| InChI | InChI=1S/C19H25FN4O3S.HI/c1-21-19(22-9-10-27-2)23-13-16-6-4-8-18(12-16)28(25,26)24-14-15-5-3-7-17(20)11-15;/h3-8,11-12,24H,9-10,13-14H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | OEWOUJZFSRKZRK-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.41 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|