C19H25FN4O2S — CID 111125456
1-[[3-[(3-fluorophenyl)methylsulfamoyl]phenyl]methyl]-2-methyl-3-propan-2-ylguanidine (PubChem CID 111125456) has the molecular formula C19H25FN4O2S and a molecular weight of 392.50 g/mol. Its IUPAC name is 1-[[3-[(3-fluorophenyl)methylsulfamoyl]phenyl]methyl]-2-methyl-3-propan-2-ylguanidine.
| Compound Name | 1-[[3-[(3-fluorophenyl)methylsulfamoyl]phenyl]methyl]-2-methyl-3-propan-2-ylguanidine |
|---|---|
| PubChem CID | 111125456 |
| Molecular Formula | C19H25FN4O2S |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 1-[[3-[(3-fluorophenyl)methylsulfamoyl]phenyl]methyl]-2-methyl-3-propan-2-ylguanidine |
| SMILES | C/N=C(/NCc1cccc(S(=O)(=O)NCc2cccc(F)c2)c1)NC(C)C |
| InChI | InChI=1S/C19H25FN4O2S/c1-14(2)24-19(21-3)22-12-16-7-5-9-18(11-16)27(25,26)23-13-15-6-4-8-17(20)10-15/h4-11,14,23H,12-13H2,1-3H3,(H2,21,22,24) |
| InChIKey | ANXTWJPWZJILCT-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|