C17H20FN5O4S — CID 111877157
1-[(3-fluorophenyl)methyl]-2-methyl-3-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine (PubChem CID 111877157) has the molecular formula C17H20FN5O4S and a molecular weight of 409.44 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methyl]-2-methyl-3-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine.
| Compound Name | 1-[(3-fluorophenyl)methyl]-2-methyl-3-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine |
|---|---|
| PubChem CID | 111877157 |
| Molecular Formula | C17H20FN5O4S |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 1-[(3-fluorophenyl)methyl]-2-methyl-3-[2-[(3-nitrophenyl)sulfonylamino]ethyl]guanidine |
| SMILES | C/N=C(/NCCNS(=O)(=O)c1cccc([N+](=O)[O-])c1)NCc1cccc(F)c1 |
| InChI | InChI=1S/C17H20FN5O4S/c1-19-17(21-12-13-4-2-5-14(18)10-13)20-8-9-22-28(26,27)16-7-3-6-15(11-16)23(24)25/h2-7,10-11,22H,8-9,12H2,1H3,(H2,19,20,21) |
| InChIKey | RVFFCDSPELTKDF-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 125.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|