C19H18FN5O3S — CID 55946410
3-amino-N-[[3-[(3-fluorophenyl)methylsulfamoyl]phenyl]methyl]pyrazine-2-carboxamide (PubChem CID 55946410) has the molecular formula C19H18FN5O3S and a molecular weight of 415.45 g/mol. Its IUPAC name is 3-amino-N-[[3-[(3-fluorophenyl)methylsulfamoyl]phenyl]methyl]pyrazine-2-carboxamide.
| Compound Name | 3-amino-N-[[3-[(3-fluorophenyl)methylsulfamoyl]phenyl]methyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 55946410 |
| Molecular Formula | C19H18FN5O3S |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | 3-amino-N-[[3-[(3-fluorophenyl)methylsulfamoyl]phenyl]methyl]pyrazine-2-carboxamide |
| SMILES | Nc1nccnc1C(=O)NCc1cccc(S(=O)(=O)NCc2cccc(F)c2)c1 |
| InChI | InChI=1S/C19H18FN5O3S/c20-15-5-1-3-13(9-15)12-25-29(27,28)16-6-2-4-14(10-16)11-24-19(26)17-18(21)23-8-7-22-17/h1-10,25H,11-12H2,(H2,21,23)(H,24,26) |
| InChIKey | ODSSXGYQXDSAMS-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 127.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |