C22H24FN5O2S — CID 111068655
2-[[3-[(3-fluorophenyl)methylsulfamoyl]phenyl]methyl]-1-(2-pyridin-2-ylethyl)guanidine (PubChem CID 111068655) has the molecular formula C22H24FN5O2S and a molecular weight of 441.53 g/mol. Its IUPAC name is 2-[[3-[(3-fluorophenyl)methylsulfamoyl]phenyl]methyl]-1-(2-pyridin-2-ylethyl)guanidine.
| Compound Name | 2-[[3-[(3-fluorophenyl)methylsulfamoyl]phenyl]methyl]-1-(2-pyridin-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111068655 |
| Molecular Formula | C22H24FN5O2S |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | 2-[[3-[(3-fluorophenyl)methylsulfamoyl]phenyl]methyl]-1-(2-pyridin-2-ylethyl)guanidine |
| SMILES | N/C(=N\Cc1cccc(S(=O)(=O)NCc2cccc(F)c2)c1)NCCc1ccccn1 |
| InChI | InChI=1S/C22H24FN5O2S/c23-19-7-3-5-17(13-19)16-28-31(29,30)21-9-4-6-18(14-21)15-27-22(24)26-12-10-20-8-1-2-11-25-20/h1-9,11,13-14,28H,10,12,15-16H2,(H3,24,26,27) |
| InChIKey | KOGCSEZCAWGZTB-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 109.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|