C16H16F4N4 — CID 111044994
2-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-1-(2-pyridin-2-ylethyl)guanidine (PubChem CID 111044994) has the molecular formula C16H16F4N4 and a molecular weight of 340.32 g/mol. Its IUPAC name is 2-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-1-(2-pyridin-2-ylethyl)guanidine.
| Compound Name | 2-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-1-(2-pyridin-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111044994 |
| Molecular Formula | C16H16F4N4 |
| Molecular Weight | 340.32 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 2-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-1-(2-pyridin-2-ylethyl)guanidine |
| SMILES | N/C(=N\Cc1ccc(F)cc1C(F)(F)F)NCCc1ccccn1 |
| InChI | InChI=1S/C16H16F4N4/c17-12-5-4-11(14(9-12)16(18,19)20)10-24-15(21)23-8-6-13-3-1-2-7-22-13/h1-5,7,9H,6,8,10H2,(H3,21,23,24) |
| InChIKey | DSDDLQCNQVWSDD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|