C11H16F3IN4 — CID 111800785
1-(2-pyridin-2-ylethyl)-2-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 111800785) has the molecular formula C11H16F3IN4 and a molecular weight of 388.18 g/mol. Its IUPAC name is 1-(2-pyridin-2-ylethyl)-2-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 1-(2-pyridin-2-ylethyl)-2-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111800785 |
| Molecular Formula | C11H16F3IN4 |
| Molecular Weight | 388.18 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | 1-(2-pyridin-2-ylethyl)-2-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | I.N/C(=N\CCC(F)(F)F)NCCc1ccccn1 |
| InChI | InChI=1S/C11H15F3N4.HI/c12-11(13,14)5-8-18-10(15)17-7-4-9-3-1-2-6-16-9;/h1-3,6H,4-5,7-8H2,(H3,15,17,18);1H |
| InChIKey | DDJHMDFGIJMLLB-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.18 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|