C14H26IN5O2S — CID 111066396
2-[3-[ethylsulfonyl(methyl)amino]propyl]-1-(2-pyridin-2-ylethyl)guanidine;hydroiodide (PubChem CID 111066396) has the molecular formula C14H26IN5O2S and a molecular weight of 455.37 g/mol. Its IUPAC name is 2-[3-[ethylsulfonyl(methyl)amino]propyl]-1-(2-pyridin-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-[3-[ethylsulfonyl(methyl)amino]propyl]-1-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111066396 |
| Molecular Formula | C14H26IN5O2S |
| Molecular Weight | 455.37 g/mol |
| Exact Mass | 455.09 |
| IUPAC Name | 2-[3-[ethylsulfonyl(methyl)amino]propyl]-1-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
| SMILES | CCS(=O)(=O)N(C)CCC/N=C(\N)NCCc1ccccn1.I |
| InChI | InChI=1S/C14H25N5O2S.HI/c1-3-22(20,21)19(2)12-6-10-17-14(15)18-11-8-13-7-4-5-9-16-13;/h4-5,7,9H,3,6,8,10-12H2,1-2H3,(H3,15,17,18);1H |
| InChIKey | AOOASNCQJIWAJO-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 100.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.37 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|