C18H26IN5O2S — CID 111043857
2-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-1-(2-pyridin-2-ylethyl)guanidine;hydroiodide (PubChem CID 111043857) has the molecular formula C18H26IN5O2S and a molecular weight of 503.41 g/mol. Its IUPAC name is 2-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-1-(2-pyridin-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-1-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111043857 |
| Molecular Formula | C18H26IN5O2S |
| Molecular Weight | 503.41 g/mol |
| Exact Mass | 503.09 |
| IUPAC Name | 2-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-1-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)NCC/N=C(\N)NCCc2ccccn2)c1.I |
| InChI | InChI=1S/C18H25N5O2S.HI/c1-14-6-7-15(2)17(13-14)26(24,25)23-12-11-22-18(19)21-10-8-16-5-3-4-9-20-16;/h3-7,9,13,23H,8,10-12H2,1-2H3,(H3,19,21,22);1H |
| InChIKey | MWKIJIQTPPEVBX-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 109.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.41 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|