C16H19FN4O2S — CID 111578359
2-[2-(2-fluorophenyl)sulfonylethyl]-1-(2-pyridin-2-ylethyl)guanidine (PubChem CID 111578359) has the molecular formula C16H19FN4O2S and a molecular weight of 350.42 g/mol. Its IUPAC name is 2-[2-(2-fluorophenyl)sulfonylethyl]-1-(2-pyridin-2-ylethyl)guanidine.
| Compound Name | 2-[2-(2-fluorophenyl)sulfonylethyl]-1-(2-pyridin-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111578359 |
| Molecular Formula | C16H19FN4O2S |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 2-[2-(2-fluorophenyl)sulfonylethyl]-1-(2-pyridin-2-ylethyl)guanidine |
| SMILES | N/C(=N\CCS(=O)(=O)c1ccccc1F)NCCc1ccccn1 |
| InChI | InChI=1S/C16H19FN4O2S/c17-14-6-1-2-7-15(14)24(22,23)12-11-21-16(18)20-10-8-13-5-3-4-9-19-13/h1-7,9H,8,10-12H2,(H3,18,20,21) |
| InChIKey | VSFRJOUZOWXEMP-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 97.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|