C17H29FIN3O2S — CID 111813043
1-[2-(2-fluorophenyl)sulfonylethyl]-2-octylguanidine;hydroiodide (PubChem CID 111813043) has the molecular formula C17H29FIN3O2S and a molecular weight of 485.41 g/mol. Its IUPAC name is 1-[2-(2-fluorophenyl)sulfonylethyl]-2-octylguanidine;hydroiodide.
| Compound Name | 1-[2-(2-fluorophenyl)sulfonylethyl]-2-octylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111813043 |
| Molecular Formula | C17H29FIN3O2S |
| Molecular Weight | 485.41 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | 1-[2-(2-fluorophenyl)sulfonylethyl]-2-octylguanidine;hydroiodide |
| SMILES | CCCCCCCC/N=C(\N)NCCS(=O)(=O)c1ccccc1F.I |
| InChI | InChI=1S/C17H28FN3O2S.HI/c1-2-3-4-5-6-9-12-20-17(19)21-13-14-24(22,23)16-11-8-7-10-15(16)18;/h7-8,10-11H,2-6,9,12-14H2,1H3,(H3,19,20,21);1H |
| InChIKey | JPNNZHDRFDXVAG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|