C16H25FN4O — CID 111075665
2-fluoro-N-[2-[(N'-hexylcarbamimidoyl)amino]ethyl]benzamide (PubChem CID 111075665) has the molecular formula C16H25FN4O and a molecular weight of 308.40 g/mol. Its IUPAC name is 2-fluoro-N-[2-[(N'-hexylcarbamimidoyl)amino]ethyl]benzamide.
| Compound Name | 2-fluoro-N-[2-[(N'-hexylcarbamimidoyl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 111075665 |
| Molecular Formula | C16H25FN4O |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 2-fluoro-N-[2-[(N'-hexylcarbamimidoyl)amino]ethyl]benzamide |
| SMILES | CCCCCC/N=C(\N)NCCNC(=O)c1ccccc1F |
| InChI | InChI=1S/C16H25FN4O/c1-2-3-4-7-10-20-16(18)21-12-11-19-15(22)13-8-5-6-9-14(13)17/h5-6,8-9H,2-4,7,10-12H2,1H3,(H,19,22)(H3,18,20,21) |
| InChIKey | OJTYEFBOUJOGPJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|