C17H26FN5O — CID 111075697
N-[2-[[N'-[(1-ethylpyrrolidin-2-yl)methyl]carbamimidoyl]amino]ethyl]-2-fluorobenzamide (PubChem CID 111075697) has the molecular formula C17H26FN5O and a molecular weight of 335.43 g/mol. Its IUPAC name is N-[2-[[N'-[(1-ethylpyrrolidin-2-yl)methyl]carbamimidoyl]amino]ethyl]-2-fluorobenzamide.
| Compound Name | N-[2-[[N'-[(1-ethylpyrrolidin-2-yl)methyl]carbamimidoyl]amino]ethyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 111075697 |
| Molecular Formula | C17H26FN5O |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | N-[2-[[N'-[(1-ethylpyrrolidin-2-yl)methyl]carbamimidoyl]amino]ethyl]-2-fluorobenzamide |
| SMILES | CCN1CCCC1C/N=C(\N)NCCNC(=O)c1ccccc1F |
| InChI | InChI=1S/C17H26FN5O/c1-2-23-11-5-6-13(23)12-22-17(19)21-10-9-20-16(24)14-7-3-4-8-15(14)18/h3-4,7-8,13H,2,5-6,9-12H2,1H3,(H,20,24)(H3,19,21,22) |
| InChIKey | HSMVTIKKVRUVSU-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|