C16H24BrFN4 — CID 111077839
1-[2-(5-bromo-2-fluorophenyl)ethyl]-2-[(1-ethylpyrrolidin-2-yl)methyl]guanidine (PubChem CID 111077839) has the molecular formula C16H24BrFN4 and a molecular weight of 371.30 g/mol. Its IUPAC name is 1-[2-(5-bromo-2-fluorophenyl)ethyl]-2-[(1-ethylpyrrolidin-2-yl)methyl]guanidine.
| Compound Name | 1-[2-(5-bromo-2-fluorophenyl)ethyl]-2-[(1-ethylpyrrolidin-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111077839 |
| Molecular Formula | C16H24BrFN4 |
| Molecular Weight | 371.30 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 1-[2-(5-bromo-2-fluorophenyl)ethyl]-2-[(1-ethylpyrrolidin-2-yl)methyl]guanidine |
| SMILES | CCN1CCCC1C/N=C(\N)NCCc1cc(Br)ccc1F |
| InChI | InChI=1S/C16H24BrFN4/c1-2-22-9-3-4-14(22)11-21-16(19)20-8-7-12-10-13(17)5-6-15(12)18/h5-6,10,14H,2-4,7-9,11H2,1H3,(H3,19,20,21) |
| InChIKey | KRVMGFLTRGYDOX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.30 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|