C19H26FN5O — CID 111097117
2-[(1-ethylpyrrolidin-2-yl)methyl]-1-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]guanidine (PubChem CID 111097117) has the molecular formula C19H26FN5O and a molecular weight of 359.45 g/mol. Its IUPAC name is 2-[(1-ethylpyrrolidin-2-yl)methyl]-1-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]guanidine.
| Compound Name | 2-[(1-ethylpyrrolidin-2-yl)methyl]-1-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]guanidine |
|---|---|
| PubChem CID | 111097117 |
| Molecular Formula | C19H26FN5O |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | 2-[(1-ethylpyrrolidin-2-yl)methyl]-1-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]guanidine |
| SMILES | CCN1CCCC1C/N=C(\N)NCCc1coc(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C19H26FN5O/c1-2-25-11-3-4-17(25)12-23-19(21)22-10-9-16-13-26-18(24-16)14-5-7-15(20)8-6-14/h5-8,13,17H,2-4,9-12H2,1H3,(H3,21,22,23) |
| InChIKey | ZYORGYQSHUEVPF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 79.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|