C20H31IN6O — CID 111100341
1-[2-[4-(3-ethyl-1,2,4-oxadiazol-5-yl)phenyl]ethyl]-2-[(1-ethylpyrrolidin-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111100341) has the molecular formula C20H31IN6O and a molecular weight of 498.41 g/mol. Its IUPAC name is 1-[2-[4-(3-ethyl-1,2,4-oxadiazol-5-yl)phenyl]ethyl]-2-[(1-ethylpyrrolidin-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-[4-(3-ethyl-1,2,4-oxadiazol-5-yl)phenyl]ethyl]-2-[(1-ethylpyrrolidin-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111100341 |
| Molecular Formula | C20H31IN6O |
| Molecular Weight | 498.41 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | 1-[2-[4-(3-ethyl-1,2,4-oxadiazol-5-yl)phenyl]ethyl]-2-[(1-ethylpyrrolidin-2-yl)methyl]guanidine;hydroiodide |
| SMILES | CCc1noc(-c2ccc(CCN/C(N)=N/CC3CCCN3CC)cc2)n1.I |
| InChI | InChI=1S/C20H30N6O.HI/c1-3-18-24-19(27-25-18)16-9-7-15(8-10-16)11-12-22-20(21)23-14-17-6-5-13-26(17)4-2;/h7-10,17H,3-6,11-14H2,1-2H3,(H3,21,22,23);1H |
| InChIKey | COOXZTFZPAGGNO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 92.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|