C16H24Cl2N4 — CID 111083811
1-[2-(3,5-dichlorophenyl)ethyl]-2-[(1-ethylpyrrolidin-2-yl)methyl]guanidine (PubChem CID 111083811) has the molecular formula C16H24Cl2N4 and a molecular weight of 343.30 g/mol. Its IUPAC name is 1-[2-(3,5-dichlorophenyl)ethyl]-2-[(1-ethylpyrrolidin-2-yl)methyl]guanidine.
| Compound Name | 1-[2-(3,5-dichlorophenyl)ethyl]-2-[(1-ethylpyrrolidin-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111083811 |
| Molecular Formula | C16H24Cl2N4 |
| Molecular Weight | 343.30 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 1-[2-(3,5-dichlorophenyl)ethyl]-2-[(1-ethylpyrrolidin-2-yl)methyl]guanidine |
| SMILES | CCN1CCCC1C/N=C(\N)NCCc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C16H24Cl2N4/c1-2-22-7-3-4-15(22)11-21-16(19)20-6-5-12-8-13(17)10-14(18)9-12/h8-10,15H,2-7,11H2,1H3,(H3,19,20,21) |
| InChIKey | MRAXINQRMCXDCQ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.30 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|