C20H28FIN4O2 — CID 111959298
4-ethoxy-N-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-N'-methylpiperidine-1-carboximidamide;hydroiodide (PubChem CID 111959298) has the molecular formula C20H28FIN4O2 and a molecular weight of 502.37 g/mol. Its IUPAC name is 4-ethoxy-N-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-N'-methylpiperidine-1-carboximidamide;hydroiodide.
| Compound Name | 4-ethoxy-N-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-N'-methylpiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111959298 |
| Molecular Formula | C20H28FIN4O2 |
| Molecular Weight | 502.37 g/mol |
| Exact Mass | 502.12 |
| IUPAC Name | 4-ethoxy-N-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-N'-methylpiperidine-1-carboximidamide;hydroiodide |
| SMILES | CCOC1CCN(/C(=N/C)NCCc2coc(-c3ccc(F)cc3)n2)CC1.I |
| InChI | InChI=1S/C20H27FN4O2.HI/c1-3-26-18-9-12-25(13-10-18)20(22-2)23-11-8-17-14-27-19(24-17)15-4-6-16(21)7-5-15;/h4-7,14,18H,3,8-13H2,1-2H3,(H,22,23);1H |
| InChIKey | XZQCYIRCUPDYSD-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 62.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.37 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|