C19H25FN4O — CID 111739984
N-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-N',3,3-trimethylpyrrolidine-1-carboximidamide (PubChem CID 111739984) has the molecular formula C19H25FN4O and a molecular weight of 344.43 g/mol. Its IUPAC name is N-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-N',3,3-trimethylpyrrolidine-1-carboximidamide.
| Compound Name | N-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-N',3,3-trimethylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111739984 |
| Molecular Formula | C19H25FN4O |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | N-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-N',3,3-trimethylpyrrolidine-1-carboximidamide |
| SMILES | C/N=C(/NCCc1coc(-c2ccc(F)cc2)n1)N1CCC(C)(C)C1 |
| InChI | InChI=1S/C19H25FN4O/c1-19(2)9-11-24(13-19)18(21-3)22-10-8-16-12-25-17(23-16)14-4-6-15(20)7-5-14/h4-7,12H,8-11,13H2,1-3H3,(H,21,22) |
| InChIKey | SJARHRHRUAAWIJ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 53.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|