C22H29FN4O — CID 111732923
N-ethyl-N'-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-2-azaspiro[4.4]nonane-2-carboximidamide (PubChem CID 111732923) has the molecular formula C22H29FN4O and a molecular weight of 384.50 g/mol. Its IUPAC name is N-ethyl-N'-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-2-azaspiro[4.4]nonane-2-carboximidamide.
| Compound Name | N-ethyl-N'-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-2-azaspiro[4.4]nonane-2-carboximidamide |
|---|---|
| PubChem CID | 111732923 |
| Molecular Formula | C22H29FN4O |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | N-ethyl-N'-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-2-azaspiro[4.4]nonane-2-carboximidamide |
| SMILES | CCN/C(=N\CCc1coc(-c2ccc(F)cc2)n1)N1CCC2(CCCC2)C1 |
| InChI | InChI=1S/C22H29FN4O/c1-2-24-21(27-14-12-22(16-27)10-3-4-11-22)25-13-9-19-15-28-20(26-19)17-5-7-18(23)8-6-17/h5-8,15H,2-4,9-14,16H2,1H3,(H,24,25) |
| InChIKey | YHYWYDRJZLETMS-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 53.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|