C21H27F4N5O — CID 109376859
N-ethyl-N'-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide (PubChem CID 109376859) has the molecular formula C21H27F4N5O and a molecular weight of 441.47 g/mol. Its IUPAC name is N-ethyl-N'-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109376859 |
| Molecular Formula | C21H27F4N5O |
| Molecular Weight | 441.47 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | N-ethyl-N'-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCc1coc(-c2ccc(F)cc2)n1)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C21H27F4N5O/c1-3-26-20(30-12-10-29(11-13-30)15(2)21(23,24)25)27-9-8-18-14-31-19(28-18)16-4-6-17(22)7-5-16/h4-7,14-15H,3,8-13H2,1-2H3,(H,26,27) |
| InChIKey | LLWNNXJKKCEJEU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 56.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.47 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|