C18H26F3N7O — CID 109379084
N-ethyl-N'-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide (PubChem CID 109379084) has the molecular formula C18H26F3N7O and a molecular weight of 413.45 g/mol. Its IUPAC name is N-ethyl-N'-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109379084 |
| Molecular Formula | C18H26F3N7O |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | N-ethyl-N'-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCc1nc(-c2ccco2)n[nH]1)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C18H26F3N7O/c1-3-22-17(28-10-8-27(9-11-28)13(2)18(19,20)21)23-7-6-15-24-16(26-25-15)14-5-4-12-29-14/h4-5,12-13H,3,6-11H2,1-2H3,(H,22,23)(H,24,25,26) |
| InChIKey | WRSJPZVFQQAPAS-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 85.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|