C23H31N7O — CID 111765801
1-ethyl-3-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]-2-(2-phenyl-2-pyrrolidin-1-ylethyl)guanidine (PubChem CID 111765801) has the molecular formula C23H31N7O and a molecular weight of 421.55 g/mol. Its IUPAC name is 1-ethyl-3-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]-2-(2-phenyl-2-pyrrolidin-1-ylethyl)guanidine.
| Compound Name | 1-ethyl-3-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]-2-(2-phenyl-2-pyrrolidin-1-ylethyl)guanidine |
|---|---|
| PubChem CID | 111765801 |
| Molecular Formula | C23H31N7O |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.26 |
| IUPAC Name | 1-ethyl-3-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]-2-(2-phenyl-2-pyrrolidin-1-ylethyl)guanidine |
| SMILES | CCN/C(=N\CC(c1ccccc1)N1CCCC1)NCCc1nc(-c2ccco2)n[nH]1 |
| InChI | InChI=1S/C23H31N7O/c1-2-24-23(25-13-12-21-27-22(29-28-21)20-11-8-16-31-20)26-17-19(30-14-6-7-15-30)18-9-4-3-5-10-18/h3-5,8-11,16,19H,2,6-7,12-15,17H2,1H3,(H2,24,25,26)(H,27,28,29) |
| InChIKey | PIEFTMFQDFLZJK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 94.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|