C21H28IN7O — CID 111838242
1-[[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]-2-methyl-3-(2-phenyl-2-pyrrolidin-1-ylethyl)guanidine;hydroiodide (PubChem CID 111838242) has the molecular formula C21H28IN7O and a molecular weight of 521.41 g/mol. Its IUPAC name is 1-[[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]-2-methyl-3-(2-phenyl-2-pyrrolidin-1-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-[[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]-2-methyl-3-(2-phenyl-2-pyrrolidin-1-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111838242 |
| Molecular Formula | C21H28IN7O |
| Molecular Weight | 521.41 g/mol |
| Exact Mass | 521.14 |
| IUPAC Name | 1-[[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]-2-methyl-3-(2-phenyl-2-pyrrolidin-1-ylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1nc(-c2ccco2)n[nH]1)NCC(c1ccccc1)N1CCCC1.I |
| InChI | InChI=1S/C21H27N7O.HI/c1-22-21(24-15-19-25-20(27-26-19)18-10-7-13-29-18)23-14-17(28-11-5-6-12-28)16-8-3-2-4-9-16;/h2-4,7-10,13,17H,5-6,11-12,14-15H2,1H3,(H2,22,23,24)(H,25,26,27);1H |
| InChIKey | GFGFOTYLKBZAEA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 94.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.41 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|