C19H22IN7O — CID 111833956
1-[[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111833956) has the molecular formula C19H22IN7O and a molecular weight of 491.34 g/mol. Its IUPAC name is 1-[[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111833956 |
| Molecular Formula | C19H22IN7O |
| Molecular Weight | 491.34 g/mol |
| Exact Mass | 491.09 |
| IUPAC Name | 1-[[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1c[nH]c2ccccc12)NCc1nc(-c2ccco2)n[nH]1.I |
| InChI | InChI=1S/C19H21N7O.HI/c1-20-19(21-9-8-13-11-22-15-6-3-2-5-14(13)15)23-12-17-24-18(26-25-17)16-7-4-10-27-16;/h2-7,10-11,22H,8-9,12H2,1H3,(H2,20,21,23)(H,24,25,26);1H |
| InChIKey | HXBXKPGFNIOHIW-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.34 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|