C19H24N6O3 — CID 111836221
1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]-2-methylguanidine (PubChem CID 111836221) has the molecular formula C19H24N6O3 and a molecular weight of 384.44 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]-2-methylguanidine.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111836221 |
| Molecular Formula | C19H24N6O3 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]-2-methylguanidine |
| SMILES | C/N=C(/NCCc1ccc(OC)c(OC)c1)NCc1nc(-c2ccco2)n[nH]1 |
| InChI | InChI=1S/C19H24N6O3/c1-20-19(21-9-8-13-6-7-14(26-2)16(11-13)27-3)22-12-17-23-18(25-24-17)15-5-4-10-28-15/h4-7,10-11H,8-9,12H2,1-3H3,(H2,20,21,22)(H,23,24,25) |
| InChIKey | WKBNKTJUNUMQIT-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 109.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|