C19H22F3IN6O — CID 111765134
1-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]-2-methyl-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide (PubChem CID 111765134) has the molecular formula C19H22F3IN6O and a molecular weight of 534.32 g/mol. Its IUPAC name is 1-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]-2-methyl-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide.
| Compound Name | 1-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]-2-methyl-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111765134 |
| Molecular Formula | C19H22F3IN6O |
| Molecular Weight | 534.32 g/mol |
| Exact Mass | 534.09 |
| IUPAC Name | 1-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]-2-methyl-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1ccc(C(F)(F)F)cc1)NCCc1nc(-c2ccco2)n[nH]1.I |
| InChI | InChI=1S/C19H21F3N6O.HI/c1-23-18(24-10-8-13-4-6-14(7-5-13)19(20,21)22)25-11-9-16-26-17(28-27-16)15-3-2-12-29-15;/h2-7,12H,8-11H2,1H3,(H2,23,24,25)(H,26,27,28);1H |
| InChIKey | COVHAHPLRZKOOK-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 91.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.32 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|