C19H24FIN6O3S — CID 109445364
1-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-3-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]-2-methylguanidine;hydroiodide (PubChem CID 109445364) has the molecular formula C19H24FIN6O3S and a molecular weight of 562.41 g/mol. Its IUPAC name is 1-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-3-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-3-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109445364 |
| Molecular Formula | C19H24FIN6O3S |
| Molecular Weight | 562.41 g/mol |
| Exact Mass | 562.07 |
| IUPAC Name | 1-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-3-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1nc(-c2ccco2)n[nH]1)NCc1cc(F)ccc1CS(C)(=O)=O.I |
| InChI | InChI=1S/C19H23FN6O3S.HI/c1-21-19(22-8-7-17-24-18(26-25-17)16-4-3-9-29-16)23-11-14-10-15(20)6-5-13(14)12-30(2,27)28;/h3-6,9-10H,7-8,11-12H2,1-2H3,(H2,21,22,23)(H,24,25,26);1H |
| InChIKey | KFEKYKXEGXRNPO-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 125.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.41 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|