C19H23F2N3O2S2 — CID 109445355
1-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-3-[2-(4-fluorophenyl)sulfanylethyl]-2-methylguanidine (PubChem CID 109445355) has the molecular formula C19H23F2N3O2S2 and a molecular weight of 427.54 g/mol. Its IUPAC name is 1-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-3-[2-(4-fluorophenyl)sulfanylethyl]-2-methylguanidine.
| Compound Name | 1-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-3-[2-(4-fluorophenyl)sulfanylethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 109445355 |
| Molecular Formula | C19H23F2N3O2S2 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 1-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-3-[2-(4-fluorophenyl)sulfanylethyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCSc1ccc(F)cc1)NCc1cc(F)ccc1CS(C)(=O)=O |
| InChI | InChI=1S/C19H23F2N3O2S2/c1-22-19(23-9-10-27-18-7-5-16(20)6-8-18)24-12-15-11-17(21)4-3-14(15)13-28(2,25)26/h3-8,11H,9-10,12-13H2,1-2H3,(H2,22,23,24) |
| InChIKey | XHTRFRNFLGLFRC-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|