C20H24F2N4O3S — CID 109445329
2-fluoro-N-[2-[[N-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]ethyl]benzamide (PubChem CID 109445329) has the molecular formula C20H24F2N4O3S and a molecular weight of 438.50 g/mol. Its IUPAC name is 2-fluoro-N-[2-[[N-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]ethyl]benzamide.
| Compound Name | 2-fluoro-N-[2-[[N-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 109445329 |
| Molecular Formula | C20H24F2N4O3S |
| Molecular Weight | 438.50 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 2-fluoro-N-[2-[[N-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]ethyl]benzamide |
| SMILES | C/N=C(\NCCNC(=O)c1ccccc1F)NCc1cc(F)ccc1CS(C)(=O)=O |
| InChI | InChI=1S/C20H24F2N4O3S/c1-23-20(25-10-9-24-19(27)17-5-3-4-6-18(17)22)26-12-15-11-16(21)8-7-14(15)13-30(2,28)29/h3-8,11H,9-10,12-13H2,1-2H3,(H,24,27)(H2,23,25,26) |
| InChIKey | ACNPMMQUTQDAEX-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.50 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|