C16H26FIN4O3S — CID 109444444
3-[[N-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]-N,N-dimethylpropanamide;hydroiodide (PubChem CID 109444444) has the molecular formula C16H26FIN4O3S and a molecular weight of 500.38 g/mol. Its IUPAC name is 3-[[N-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]-N,N-dimethylpropanamide;hydroiodide.
| Compound Name | 3-[[N-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]-N,N-dimethylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 109444444 |
| Molecular Formula | C16H26FIN4O3S |
| Molecular Weight | 500.38 g/mol |
| Exact Mass | 500.08 |
| IUPAC Name | 3-[[N-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]-N,N-dimethylpropanamide;hydroiodide |
| SMILES | C/N=C(\NCCC(=O)N(C)C)NCc1cc(F)ccc1CS(C)(=O)=O.I |
| InChI | InChI=1S/C16H25FN4O3S.HI/c1-18-16(19-8-7-15(22)21(2)3)20-10-13-9-14(17)6-5-12(13)11-25(4,23)24;/h5-6,9H,7-8,10-11H2,1-4H3,(H2,18,19,20);1H |
| InChIKey | DXRSDAUCWCBDBA-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.38 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|