C13H19F3IN3O2S — CID 109445366
1-(2,2-difluoroethyl)-3-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methylguanidine;hydroiodide (PubChem CID 109445366) has the molecular formula C13H19F3IN3O2S and a molecular weight of 465.28 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-3-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-(2,2-difluoroethyl)-3-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109445366 |
| Molecular Formula | C13H19F3IN3O2S |
| Molecular Weight | 465.28 g/mol |
| Exact Mass | 465.02 |
| IUPAC Name | 1-(2,2-difluoroethyl)-3-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cc(F)ccc1CS(C)(=O)=O)NCC(F)F.I |
| InChI | InChI=1S/C13H18F3N3O2S.HI/c1-17-13(19-7-12(15)16)18-6-10-5-11(14)4-3-9(10)8-22(2,20)21;/h3-5,12H,6-8H2,1-2H3,(H2,17,18,19);1H |
| InChIKey | CLUHYRIDZGDCTI-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.28 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|