C20H34FIN4O2S — CID 109445376
1-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methyl-3-(3-methyl-2-pyrrolidin-1-ylbutyl)guanidine;hydroiodide (PubChem CID 109445376) has the molecular formula C20H34FIN4O2S and a molecular weight of 540.49 g/mol. Its IUPAC name is 1-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methyl-3-(3-methyl-2-pyrrolidin-1-ylbutyl)guanidine;hydroiodide.
| Compound Name | 1-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methyl-3-(3-methyl-2-pyrrolidin-1-ylbutyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109445376 |
| Molecular Formula | C20H34FIN4O2S |
| Molecular Weight | 540.49 g/mol |
| Exact Mass | 540.14 |
| IUPAC Name | 1-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methyl-3-(3-methyl-2-pyrrolidin-1-ylbutyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cc(F)ccc1CS(C)(=O)=O)NCC(C(C)C)N1CCCC1.I |
| InChI | InChI=1S/C20H33FN4O2S.HI/c1-15(2)19(25-9-5-6-10-25)13-24-20(22-3)23-12-17-11-18(21)8-7-16(17)14-28(4,26)27;/h7-8,11,15,19H,5-6,9-10,12-14H2,1-4H3,(H2,22,23,24);1H |
| InChIKey | BVYJPBZONOULAH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.49 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|