C21H35FN4O3S — CID 109444461
1-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methyl-3-(4-methyl-2-morpholin-4-ylpentyl)guanidine (PubChem CID 109444461) has the molecular formula C21H35FN4O3S and a molecular weight of 442.60 g/mol. Its IUPAC name is 1-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methyl-3-(4-methyl-2-morpholin-4-ylpentyl)guanidine.
| Compound Name | 1-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methyl-3-(4-methyl-2-morpholin-4-ylpentyl)guanidine |
|---|---|
| PubChem CID | 109444461 |
| Molecular Formula | C21H35FN4O3S |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 1-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methyl-3-(4-methyl-2-morpholin-4-ylpentyl)guanidine |
| SMILES | C/N=C(/NCc1cc(F)ccc1CS(C)(=O)=O)NCC(CC(C)C)N1CCOCC1 |
| InChI | InChI=1S/C21H35FN4O3S/c1-16(2)11-20(26-7-9-29-10-8-26)14-25-21(23-3)24-13-18-12-19(22)6-5-17(18)15-30(4,27)28/h5-6,12,16,20H,7-11,13-15H2,1-4H3,(H2,23,24,25) |
| InChIKey | QMSQCXAEQFOVSP-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|