C17H20IN9O — CID 111760134
1-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111760134) has the molecular formula C17H20IN9O and a molecular weight of 493.31 g/mol. Its IUPAC name is 1-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111760134 |
| Molecular Formula | C17H20IN9O |
| Molecular Weight | 493.31 g/mol |
| Exact Mass | 493.08 |
| IUPAC Name | 1-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1nc(-c2ccco2)n[nH]1)NCc1nnc2ccccn12.I |
| InChI | InChI=1S/C17H19N9O.HI/c1-18-17(20-11-15-24-23-14-6-2-3-9-26(14)15)19-8-7-13-21-16(25-22-13)12-5-4-10-27-12;/h2-6,9-10H,7-8,11H2,1H3,(H2,18,19,20)(H,21,22,25);1H |
| InChIKey | JWWZELIPMNEIAM-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 121.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.31 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|