C17H20FIN6 — CID 111015680
1-[2-(2-fluorophenyl)ethyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111015680) has the molecular formula C17H20FIN6 and a molecular weight of 454.29 g/mol. Its IUPAC name is 1-[2-(2-fluorophenyl)ethyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(2-fluorophenyl)ethyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111015680 |
| Molecular Formula | C17H20FIN6 |
| Molecular Weight | 454.29 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | 1-[2-(2-fluorophenyl)ethyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1ccccc1F)NCc1nnc2ccccn12.I |
| InChI | InChI=1S/C17H19FN6.HI/c1-19-17(20-10-9-13-6-2-3-7-14(13)18)21-12-16-23-22-15-8-4-5-11-24(15)16;/h2-8,11H,9-10,12H2,1H3,(H2,19,20,21);1H |
| InChIKey | XQDUHRXCAFIRIN-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.29 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|