C17H20FIN6O2S — CID 111578206
1-[2-(2-fluorophenyl)sulfonylethyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111578206) has the molecular formula C17H20FIN6O2S and a molecular weight of 518.36 g/mol. Its IUPAC name is 1-[2-(2-fluorophenyl)sulfonylethyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(2-fluorophenyl)sulfonylethyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111578206 |
| Molecular Formula | C17H20FIN6O2S |
| Molecular Weight | 518.36 g/mol |
| Exact Mass | 518.04 |
| IUPAC Name | 1-[2-(2-fluorophenyl)sulfonylethyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCS(=O)(=O)c1ccccc1F)NCc1nnc2ccccn12.I |
| InChI | InChI=1S/C17H19FN6O2S.HI/c1-19-17(21-12-16-23-22-15-8-4-5-10-24(15)16)20-9-11-27(25,26)14-7-3-2-6-13(14)18;/h2-8,10H,9,11-12H2,1H3,(H2,19,20,21);1H |
| InChIKey | OWMBVRMWUBVAGR-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.36 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|