C17H19F2IN6O — CID 111834440
1-[2-(3,4-difluorophenoxy)ethyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111834440) has the molecular formula C17H19F2IN6O and a molecular weight of 488.28 g/mol. Its IUPAC name is 1-[2-(3,4-difluorophenoxy)ethyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(3,4-difluorophenoxy)ethyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111834440 |
| Molecular Formula | C17H19F2IN6O |
| Molecular Weight | 488.28 g/mol |
| Exact Mass | 488.06 |
| IUPAC Name | 1-[2-(3,4-difluorophenoxy)ethyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCOc1ccc(F)c(F)c1)NCc1nnc2ccccn12.I |
| InChI | InChI=1S/C17H18F2N6O.HI/c1-20-17(21-7-9-26-12-5-6-13(18)14(19)10-12)22-11-16-24-23-15-4-2-3-8-25(15)16;/h2-6,8,10H,7,9,11H2,1H3,(H2,20,21,22);1H |
| InChIKey | ZHICNHWDZOLEIL-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|