C18H20F3IN6O — CID 111014400
2-methyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-3-[2-[4-(trifluoromethyl)phenoxy]ethyl]guanidine;hydroiodide (PubChem CID 111014400) has the molecular formula C18H20F3IN6O and a molecular weight of 520.30 g/mol. Its IUPAC name is 2-methyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-3-[2-[4-(trifluoromethyl)phenoxy]ethyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-3-[2-[4-(trifluoromethyl)phenoxy]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111014400 |
| Molecular Formula | C18H20F3IN6O |
| Molecular Weight | 520.30 g/mol |
| Exact Mass | 520.07 |
| IUPAC Name | 2-methyl-1-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-3-[2-[4-(trifluoromethyl)phenoxy]ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCOc1ccc(C(F)(F)F)cc1)NCc1nnc2ccccn12.I |
| InChI | InChI=1S/C18H19F3N6O.HI/c1-22-17(24-12-16-26-25-15-4-2-3-10-27(15)16)23-9-11-28-14-7-5-13(6-8-14)18(19,20)21;/h2-8,10H,9,11-12H2,1H3,(H2,22,23,24);1H |
| InChIKey | DCBZLTPRNAMNOX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.30 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|