C18H23IN6O — CID 111014682
2-methyl-1-[2-(4-methylphenoxy)ethyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111014682) has the molecular formula C18H23IN6O and a molecular weight of 466.33 g/mol. Its IUPAC name is 2-methyl-1-[2-(4-methylphenoxy)ethyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[2-(4-methylphenoxy)ethyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111014682 |
| Molecular Formula | C18H23IN6O |
| Molecular Weight | 466.33 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | 2-methyl-1-[2-(4-methylphenoxy)ethyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCOc1ccc(C)cc1)NCc1nnc2ccccn12.I |
| InChI | InChI=1S/C18H22N6O.HI/c1-14-6-8-15(9-7-14)25-12-10-20-18(19-2)21-13-17-23-22-16-5-3-4-11-24(16)17;/h3-9,11H,10,12-13H2,1-2H3,(H2,19,20,21);1H |
| InChIKey | LRCXQDUGARESGV-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|