C18H30N6 — CID 111015915
2-methyl-1-nonyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine (PubChem CID 111015915) has the molecular formula C18H30N6 and a molecular weight of 330.48 g/mol. Its IUPAC name is 2-methyl-1-nonyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine.
| Compound Name | 2-methyl-1-nonyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111015915 |
| Molecular Formula | C18H30N6 |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.25 |
| IUPAC Name | 2-methyl-1-nonyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
| SMILES | CCCCCCCCCN/C(=N\C)NCc1nnc2ccccn12 |
| InChI | InChI=1S/C18H30N6/c1-3-4-5-6-7-8-10-13-20-18(19-2)21-15-17-23-22-16-12-9-11-14-24(16)17/h9,11-12,14H,3-8,10,13,15H2,1-2H3,(H2,19,20,21) |
| InChIKey | SALFMIAXLZJGOD-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|