C20H35IN6 — CID 111767824
2-methyl-1-nonyl-3-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine;hydroiodide (PubChem CID 111767824) has the molecular formula C20H35IN6 and a molecular weight of 486.45 g/mol. Its IUPAC name is 2-methyl-1-nonyl-3-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-nonyl-3-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111767824 |
| Molecular Formula | C20H35IN6 |
| Molecular Weight | 486.45 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | 2-methyl-1-nonyl-3-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine;hydroiodide |
| SMILES | CCCCCCCCCN/C(=N\C)NCCCc1nnc2ccccn12.I |
| InChI | InChI=1S/C20H34N6.HI/c1-3-4-5-6-7-8-10-15-22-20(21-2)23-16-12-14-19-25-24-18-13-9-11-17-26(18)19;/h9,11,13,17H,3-8,10,12,14-16H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | SCEHCESZYVIFAW-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.45 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|