C19H33N7 — CID 111764129
1-[2-[di(propan-2-yl)amino]ethyl]-2-methyl-3-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine (PubChem CID 111764129) has the molecular formula C19H33N7 and a molecular weight of 359.52 g/mol. Its IUPAC name is 1-[2-[di(propan-2-yl)amino]ethyl]-2-methyl-3-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine.
| Compound Name | 1-[2-[di(propan-2-yl)amino]ethyl]-2-methyl-3-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111764129 |
| Molecular Formula | C19H33N7 |
| Molecular Weight | 359.52 g/mol |
| Exact Mass | 359.28 |
| IUPAC Name | 1-[2-[di(propan-2-yl)amino]ethyl]-2-methyl-3-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine |
| SMILES | C/N=C(/NCCCc1nnc2ccccn12)NCCN(C(C)C)C(C)C |
| InChI | InChI=1S/C19H33N7/c1-15(2)25(16(3)4)14-12-22-19(20-5)21-11-8-10-18-24-23-17-9-6-7-13-26(17)18/h6-7,9,13,15-16H,8,10-12,14H2,1-5H3,(H2,20,21,22) |
| InChIKey | AIIUBYDXTOBMFJ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 69.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.52 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|