C16H26N6 — CID 111760613
2-methyl-1-pentyl-3-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine (PubChem CID 111760613) has the molecular formula C16H26N6 and a molecular weight of 302.43 g/mol. Its IUPAC name is 2-methyl-1-pentyl-3-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine.
| Compound Name | 2-methyl-1-pentyl-3-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111760613 |
| Molecular Formula | C16H26N6 |
| Molecular Weight | 302.43 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | 2-methyl-1-pentyl-3-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine |
| SMILES | CCCCCN/C(=N\C)NCCCc1nnc2ccccn12 |
| InChI | InChI=1S/C16H26N6/c1-3-4-6-11-18-16(17-2)19-12-8-10-15-21-20-14-9-5-7-13-22(14)15/h5,7,9,13H,3-4,6,8,10-12H2,1-2H3,(H2,17,18,19) |
| InChIKey | MCIOGBNBQLZXSX-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.43 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|