C17H22N6S — CID 111766431
2-methyl-1-(2-thiophen-2-ylethyl)-3-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine (PubChem CID 111766431) has the molecular formula C17H22N6S and a molecular weight of 342.47 g/mol. Its IUPAC name is 2-methyl-1-(2-thiophen-2-ylethyl)-3-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine.
| Compound Name | 2-methyl-1-(2-thiophen-2-ylethyl)-3-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111766431 |
| Molecular Formula | C17H22N6S |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 2-methyl-1-(2-thiophen-2-ylethyl)-3-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine |
| SMILES | C/N=C(/NCCCc1nnc2ccccn12)NCCc1cccs1 |
| InChI | InChI=1S/C17H22N6S/c1-18-17(20-11-9-14-6-5-13-24-14)19-10-4-8-16-22-21-15-7-2-3-12-23(15)16/h2-3,5-7,12-13H,4,8-11H2,1H3,(H2,18,19,20) |
| InChIKey | AMPLUFZOIBTBJF-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|