C13H17F3N6 — CID 109474651
2-methyl-1-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]-3-(3,3,3-trifluoropropyl)guanidine (PubChem CID 109474651) has the molecular formula C13H17F3N6 and a molecular weight of 314.31 g/mol. Its IUPAC name is 2-methyl-1-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]-3-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 2-methyl-1-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]-3-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 109474651 |
| Molecular Formula | C13H17F3N6 |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 2-methyl-1-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]-3-(3,3,3-trifluoropropyl)guanidine |
| SMILES | C/N=C(/NCCc1nnc2ccccn12)NCCC(F)(F)F |
| InChI | InChI=1S/C13H17F3N6/c1-17-12(19-8-6-13(14,15)16)18-7-5-11-21-20-10-4-2-3-9-22(10)11/h2-4,9H,5-8H2,1H3,(H2,17,18,19) |
| InChIKey | SLEASBYOZYLODH-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|