C22H31N7S — CID 111323288
2-methyl-1-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine (PubChem CID 111323288) has the molecular formula C22H31N7S and a molecular weight of 425.61 g/mol. Its IUPAC name is 2-methyl-1-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine.
| Compound Name | 2-methyl-1-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111323288 |
| Molecular Formula | C22H31N7S |
| Molecular Weight | 425.61 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | 2-methyl-1-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine |
| SMILES | C/N=C(/NCCc1nnc2ccccn12)NCC(c1cccs1)N1CCC(C)CC1 |
| InChI | InChI=1S/C22H31N7S/c1-17-9-13-28(14-10-17)18(19-6-5-15-30-19)16-25-22(23-2)24-11-8-21-27-26-20-7-3-4-12-29(20)21/h3-7,12,15,17-18H,8-11,13-14,16H2,1-2H3,(H2,23,24,25) |
| InChIKey | CLNXQTWRESHDPY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 69.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.61 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|