C20H35N5OS — CID 111323370
2-methyl-N-[2-[[N'-methyl-N-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]carbamimidoyl]amino]ethyl]propanamide (PubChem CID 111323370) has the molecular formula C20H35N5OS and a molecular weight of 393.60 g/mol. Its IUPAC name is 2-methyl-N-[2-[[N'-methyl-N-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]carbamimidoyl]amino]ethyl]propanamide.
| Compound Name | 2-methyl-N-[2-[[N'-methyl-N-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]carbamimidoyl]amino]ethyl]propanamide |
|---|---|
| PubChem CID | 111323370 |
| Molecular Formula | C20H35N5OS |
| Molecular Weight | 393.60 g/mol |
| Exact Mass | 393.26 |
| IUPAC Name | 2-methyl-N-[2-[[N'-methyl-N-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]carbamimidoyl]amino]ethyl]propanamide |
| SMILES | C/N=C(\NCCNC(=O)C(C)C)NCC(c1cccs1)N1CCC(C)CC1 |
| InChI | InChI=1S/C20H35N5OS/c1-15(2)19(26)22-9-10-23-20(21-4)24-14-17(18-6-5-13-27-18)25-11-7-16(3)8-12-25/h5-6,13,15-17H,7-12,14H2,1-4H3,(H,22,26)(H2,21,23,24) |
| InChIKey | VPQZGGQLENENDK-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.60 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|