C20H34IN7S — CID 111515888
2-methyl-1-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]-3-[4-(1,2,4-triazol-4-yl)butyl]guanidine;hydroiodide (PubChem CID 111515888) has the molecular formula C20H34IN7S and a molecular weight of 531.51 g/mol. Its IUPAC name is 2-methyl-1-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]-3-[4-(1,2,4-triazol-4-yl)butyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]-3-[4-(1,2,4-triazol-4-yl)butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111515888 |
| Molecular Formula | C20H34IN7S |
| Molecular Weight | 531.51 g/mol |
| Exact Mass | 531.16 |
| IUPAC Name | 2-methyl-1-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]-3-[4-(1,2,4-triazol-4-yl)butyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCCn1cnnc1)NCC(c1cccs1)N1CCC(C)CC1.I |
| InChI | InChI=1S/C20H33N7S.HI/c1-17-7-11-27(12-8-17)18(19-6-5-13-28-19)14-23-20(21-2)22-9-3-4-10-26-15-24-25-16-26;/h5-6,13,15-18H,3-4,7-12,14H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | WTEAYABODKNBEM-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.51 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|