C20H36IN5O2S2 — CID 111323211
1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-2-methyl-3-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]guanidine;hydroiodide (PubChem CID 111323211) has the molecular formula C20H36IN5O2S2 and a molecular weight of 569.58 g/mol. Its IUPAC name is 1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-2-methyl-3-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-2-methyl-3-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111323211 |
| Molecular Formula | C20H36IN5O2S2 |
| Molecular Weight | 569.58 g/mol |
| Exact Mass | 569.14 |
| IUPAC Name | 1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-2-methyl-3-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCN1CCS(=O)(=O)CC1)NCC(c1cccs1)N1CCC(C)CC1.I |
| InChI | InChI=1S/C20H35N5O2S2.HI/c1-17-5-8-25(9-6-17)18(19-4-3-13-28-19)16-23-20(21-2)22-7-10-24-11-14-29(26,27)15-12-24;/h3-4,13,17-18H,5-12,14-16H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | SJHJZGFGYMDQPD-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.58 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|